C24H28N6O2 — CID 56602767
(E)-N-[2-(4-acetylpiperazin-1-yl)ethyl]-N-phenyl-3-(2H-pyrazolo[3,4-b]pyridin-3-yl)but-2-enamide (PubChem CID 56602767) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is (E)-N-[2-(4-acetylpiperazin-1-yl)ethyl]-N-phenyl-3-(2H-pyrazolo[3,4-b]pyridin-3-yl)but-2-enamide.
| Compound Name | (E)-N-[2-(4-acetylpiperazin-1-yl)ethyl]-N-phenyl-3-(2H-pyrazolo[3,4-b]pyridin-3-yl)but-2-enamide |
|---|---|
| PubChem CID | 56602767 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | (E)-N-[2-(4-acetylpiperazin-1-yl)ethyl]-N-phenyl-3-(2H-pyrazolo[3,4-b]pyridin-3-yl)but-2-enamide |
| SMILES | CC(=O)N1CCN(CCN(C(=O)/C=C(\C)c2[nH]nc3ncccc23)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H28N6O2/c1-18(23-21-9-6-10-25-24(21)27-26-23)17-22(32)30(20-7-4-3-5-8-20)16-13-28-11-14-29(15-12-28)19(2)31/h3-10,17H,11-16H2,1-2H3,(H,25,26,27)/b18-17+ |
| InChIKey | QCYVABYONBFILK-ISLYRVAYSA-N |
| XLogP | 2.56 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|