C30H37N7O3 — CID 56603024
benzyl N-[6-[[2-[4-amino-3-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2-methylpropyl]amino]-6-oxohexyl]carbamate (PubChem CID 56603024) has the molecular formula C30H37N7O3 and a molecular weight of 543.67 g/mol. Its IUPAC name is benzyl N-[6-[[2-[4-amino-3-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2-methylpropyl]amino]-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[6-[[2-[4-amino-3-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2-methylpropyl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 56603024 |
| Molecular Formula | C30H37N7O3 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.30 |
| IUPAC Name | benzyl N-[6-[[2-[4-amino-3-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2-methylpropyl]amino]-6-oxohexyl]carbamate |
| SMILES | Cc1ccc(-c2nn(C(C)(C)CNC(=O)CCCCCNC(=O)OCc3ccccc3)c3ncnc(N)c23)cc1 |
| InChI | InChI=1S/C30H37N7O3/c1-21-13-15-23(16-14-21)26-25-27(31)34-20-35-28(25)37(36-26)30(2,3)19-33-24(38)12-8-5-9-17-32-29(39)40-18-22-10-6-4-7-11-22/h4,6-7,10-11,13-16,20H,5,8-9,12,17-19H2,1-3H3,(H,32,39)(H,33,38)(H2,31,34,35) |
| InChIKey | BPEVBPLZMFQLRE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 137.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|