C27H32N6O2 — CID 56603211
N-[2-[4-amino-3-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2-methylpropyl]-4-phenylmethoxybutanamide (PubChem CID 56603211) has the molecular formula C27H32N6O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is N-[2-[4-amino-3-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2-methylpropyl]-4-phenylmethoxybutanamide.
| Compound Name | N-[2-[4-amino-3-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2-methylpropyl]-4-phenylmethoxybutanamide |
|---|---|
| PubChem CID | 56603211 |
| Molecular Formula | C27H32N6O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | N-[2-[4-amino-3-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2-methylpropyl]-4-phenylmethoxybutanamide |
| SMILES | Cc1ccc(-c2nn(C(C)(C)CNC(=O)CCCOCc3ccccc3)c3ncnc(N)c23)cc1 |
| InChI | InChI=1S/C27H32N6O2/c1-19-11-13-21(14-12-19)24-23-25(28)30-18-31-26(23)33(32-24)27(2,3)17-29-22(34)10-7-15-35-16-20-8-5-4-6-9-20/h4-6,8-9,11-14,18H,7,10,15-17H2,1-3H3,(H,29,34)(H2,28,30,31) |
| InChIKey | UXMBMJVUPBRGTK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|