About 7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one
7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one (PubChem CID 56604060) has the molecular formula C8H7NO2S
and a molecular weight of 181.22 g/mol. Its IUPAC name is 7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one.
Molecular Properties
| Compound Name | 7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one |
| PubChem CID | 56604060 |
| Molecular Formula | C8H7NO2S |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one |
| SMILES | Cc1cc2[nH]c(=O)cc(O)c2s1 |
| InChI | InChI=1S/C8H7NO2S/c1-4-2-5-8(12-4)6(10)3-7(11)9-5/h2-3H,1H3,(H2,9,10,11) |
| InChIKey | UBDVSPYLFWSUAC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one?
The IUPAC name of 7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one (CID 56604060) is 7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one.
What is the SMILES notation for 7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one?
The canonical SMILES for 7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one is Cc1cc2[nH]c(=O)cc(O)c2s1.
What is the InChIKey of 7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one?
The InChIKey is UBDVSPYLFWSUAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2S/c1-4-2-5-8(12-4)6(10)3-7(11)9-5/h2-3H,1H3,(H2,9,10,11).
What are the key properties of 7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one?
7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one has a molecular weight of 181.22 g/mol, XLogP of 1.60, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one is sourced from PubChem (CID 56604060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).