About 5-hydroxy-2,6-dimethylpyridazin-3-one
5-hydroxy-2,6-dimethylpyridazin-3-one (PubChem CID 56604117) has the molecular formula C6H8N2O2
and a molecular weight of 140.14 g/mol. Its IUPAC name is 5-hydroxy-2,6-dimethylpyridazin-3-one.
Molecular Properties
| Compound Name | 5-hydroxy-2,6-dimethylpyridazin-3-one |
| PubChem CID | 56604117 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 5-hydroxy-2,6-dimethylpyridazin-3-one |
| SMILES | Cc1nn(C)c(=O)cc1O |
| InChI | InChI=1S/C6H8N2O2/c1-4-5(9)3-6(10)8(2)7-4/h3,9H,1-2H3 |
| InChIKey | KYKZWYYOWMTZNJ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-hydroxy-2,6-dimethylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2,6-dimethylpyridazin-3-one?
The IUPAC name of 5-hydroxy-2,6-dimethylpyridazin-3-one (CID 56604117) is 5-hydroxy-2,6-dimethylpyridazin-3-one.
What is the SMILES notation for 5-hydroxy-2,6-dimethylpyridazin-3-one?
The canonical SMILES for 5-hydroxy-2,6-dimethylpyridazin-3-one is Cc1nn(C)c(=O)cc1O.
What is the InChIKey of 5-hydroxy-2,6-dimethylpyridazin-3-one?
The InChIKey is KYKZWYYOWMTZNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2/c1-4-5(9)3-6(10)8(2)7-4/h3,9H,1-2H3.
What are the key properties of 5-hydroxy-2,6-dimethylpyridazin-3-one?
5-hydroxy-2,6-dimethylpyridazin-3-one has a molecular weight of 140.14 g/mol, XLogP of -0.21, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2,6-dimethylpyridazin-3-one is sourced from PubChem (CID 56604117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).