C11H6OS2 — CID 56605001
2,3-dithiatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene-7-carbaldehyde (PubChem CID 56605001) has the molecular formula C11H6OS2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2,3-dithiatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene-7-carbaldehyde.
| Compound Name | 2,3-dithiatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene-7-carbaldehyde |
|---|---|
| PubChem CID | 56605001 |
| Molecular Formula | C11H6OS2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | 2,3-dithiatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene-7-carbaldehyde |
| SMILES | O=Cc1ccc2c3c(cccc13)SS2 |
| InChI | InChI=1S/C11H6OS2/c12-6-7-4-5-10-11-8(7)2-1-3-9(11)13-14-10/h1-6H |
| InChIKey | FURBESKDIUADDG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|