C23H22N4O4 — CID 56605236
methyl 4-[6-amino-1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]oxy-3-methylpyridine-2-carboxylate (PubChem CID 56605236) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is methyl 4-[6-amino-1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]oxy-3-methylpyridine-2-carboxylate.
| Compound Name | methyl 4-[6-amino-1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]oxy-3-methylpyridine-2-carboxylate |
|---|---|
| PubChem CID | 56605236 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | methyl 4-[6-amino-1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]oxy-3-methylpyridine-2-carboxylate |
| SMILES | COC(=O)c1nccc(Oc2nc3ccc(N)cc3n2Cc2ccc(OC)cc2)c1C |
| InChI | InChI=1S/C23H22N4O4/c1-14-20(10-11-25-21(14)22(28)30-3)31-23-26-18-9-6-16(24)12-19(18)27(23)13-15-4-7-17(29-2)8-5-15/h4-12H,13,24H2,1-3H3 |
| InChIKey | FSMRPRATXQUTQA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|