C18H27F3O4 — CID 56605909
5-hexoxy-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane (PubChem CID 56605909) has the molecular formula C18H27F3O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is 5-hexoxy-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane.
| Compound Name | 5-hexoxy-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 56605909 |
| Molecular Formula | C18H27F3O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 5-hexoxy-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane |
| SMILES | CCCCCCOC1COC(C2=CCC(OCC(F)(F)F)C=C2)OC1 |
| InChI | InChI=1S/C18H27F3O4/c1-2-3-4-5-10-22-16-11-23-17(24-12-16)14-6-8-15(9-7-14)25-13-18(19,20)21/h6-8,15-17H,2-5,9-13H2,1H3 |
| InChIKey | RYHVIQFFBCNHLF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|