C22H33F3O — CID 56606008
2-(4-octylcyclohexen-1-yl)-5-(2,2,2-trifluoroethoxy)cyclohexa-1,3-diene (PubChem CID 56606008) has the molecular formula C22H33F3O and a molecular weight of 370.50 g/mol. Its IUPAC name is 2-(4-octylcyclohexen-1-yl)-5-(2,2,2-trifluoroethoxy)cyclohexa-1,3-diene.
| Compound Name | 2-(4-octylcyclohexen-1-yl)-5-(2,2,2-trifluoroethoxy)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 56606008 |
| Molecular Formula | C22H33F3O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 2-(4-octylcyclohexen-1-yl)-5-(2,2,2-trifluoroethoxy)cyclohexa-1,3-diene |
| SMILES | CCCCCCCCC1CC=C(C2=CCC(OCC(F)(F)F)C=C2)CC1 |
| InChI | InChI=1S/C22H33F3O/c1-2-3-4-5-6-7-8-18-9-11-19(12-10-18)20-13-15-21(16-14-20)26-17-22(23,24)25/h11,13-15,18,21H,2-10,12,16-17H2,1H3 |
| InChIKey | QIAIOMLSMPBRGG-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|