C11H18N2O3SSi — CID 56606027
(6S)-3-methyl-8-oxo-7-(trimethylsilylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 56606027) has the molecular formula C11H18N2O3SSi and a molecular weight of 286.43 g/mol. Its IUPAC name is (6S)-3-methyl-8-oxo-7-(trimethylsilylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-3-methyl-8-oxo-7-(trimethylsilylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 56606027 |
| Molecular Formula | C11H18N2O3SSi |
| Molecular Weight | 286.43 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | (6S)-3-methyl-8-oxo-7-(trimethylsilylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC1=C(C(=O)O)N2C(=O)C(N[Si](C)(C)C)[C@@H]2SC1 |
| InChI | InChI=1S/C11H18N2O3SSi/c1-6-5-17-10-7(12-18(2,3)4)9(14)13(10)8(6)11(15)16/h7,10,12H,5H2,1-4H3,(H,15,16)/t7?,10-/m0/s1 |
| InChIKey | ILQFQJJGZUQSMG-MHPPCMCBSA-N |
| XLogP | 1.05 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.43 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|