About 4-ethoxy-2,6-bis(trifluoromethyl)pyridine-3,5-dicarboxylic acid
4-ethoxy-2,6-bis(trifluoromethyl)pyridine-3,5-dicarboxylic acid (PubChem CID 56606193) has the molecular formula C11H7F6NO5
and a molecular weight of 347.17 g/mol. Its IUPAC name is 4-ethoxy-2,6-bis(trifluoromethyl)pyridine-3,5-dicarboxylic acid.
Molecular Properties
| Compound Name | 4-ethoxy-2,6-bis(trifluoromethyl)pyridine-3,5-dicarboxylic acid |
| PubChem CID | 56606193 |
| Molecular Formula | C11H7F6NO5 |
| Molecular Weight | 347.17 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 4-ethoxy-2,6-bis(trifluoromethyl)pyridine-3,5-dicarboxylic acid |
| SMILES | CCOc1c(C(=O)O)c(C(F)(F)F)nc(C(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C11H7F6NO5/c1-2-23-5-3(8(19)20)6(10(12,13)14)18-7(11(15,16)17)4(5)9(21)22/h2H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | PUYUALIFEOHNPD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.17 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-ethoxy-2,6-bis(trifluoromethyl)pyridine-3,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-2,6-bis(trifluoromethyl)pyridine-3,5-dicarboxylic acid?
The IUPAC name of 4-ethoxy-2,6-bis(trifluoromethyl)pyridine-3,5-dicarboxylic acid (CID 56606193) is 4-ethoxy-2,6-bis(trifluoromethyl)pyridine-3,5-dicarboxylic acid.
What is the SMILES notation for 4-ethoxy-2,6-bis(trifluoromethyl)pyridine-3,5-dicarboxylic acid?
The canonical SMILES for 4-ethoxy-2,6-bis(trifluoromethyl)pyridine-3,5-dicarboxylic acid is CCOc1c(C(=O)O)c(C(F)(F)F)nc(C(F)(F)F)c1C(=O)O.
What is the InChIKey of 4-ethoxy-2,6-bis(trifluoromethyl)pyridine-3,5-dicarboxylic acid?
The InChIKey is PUYUALIFEOHNPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7F6NO5/c1-2-23-5-3(8(19)20)6(10(12,13)14)18-7(11(15,16)17)4(5)9(21)22/h2H2,1H3,(H,19,20)(H,21,22).
What are the key properties of 4-ethoxy-2,6-bis(trifluoromethyl)pyridine-3,5-dicarboxylic acid?
4-ethoxy-2,6-bis(trifluoromethyl)pyridine-3,5-dicarboxylic acid has a molecular weight of 347.17 g/mol, XLogP of 2.91, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-2,6-bis(trifluoromethyl)pyridine-3,5-dicarboxylic acid is sourced from PubChem (CID 56606193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).