About (2-oxopropylamino) 3,3,5-trimethylcyclohexane-1-carboxylate
(2-oxopropylamino) 3,3,5-trimethylcyclohexane-1-carboxylate (PubChem CID 56606267) has the molecular formula C13H23NO3
and a molecular weight of 241.33 g/mol. Its IUPAC name is (2-oxopropylamino) 3,3,5-trimethylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (2-oxopropylamino) 3,3,5-trimethylcyclohexane-1-carboxylate |
| PubChem CID | 56606267 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | (2-oxopropylamino) 3,3,5-trimethylcyclohexane-1-carboxylate |
| SMILES | CC(=O)CNOC(=O)C1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C13H23NO3/c1-9-5-11(7-13(3,4)6-9)12(16)17-14-8-10(2)15/h9,11,14H,5-8H2,1-4H3 |
| InChIKey | RRAULEQFQVXKAK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-oxopropylamino) 3,3,5-trimethylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxopropylamino) 3,3,5-trimethylcyclohexane-1-carboxylate?
The IUPAC name of (2-oxopropylamino) 3,3,5-trimethylcyclohexane-1-carboxylate (CID 56606267) is (2-oxopropylamino) 3,3,5-trimethylcyclohexane-1-carboxylate.
What is the SMILES notation for (2-oxopropylamino) 3,3,5-trimethylcyclohexane-1-carboxylate?
The canonical SMILES for (2-oxopropylamino) 3,3,5-trimethylcyclohexane-1-carboxylate is CC(=O)CNOC(=O)C1CC(C)CC(C)(C)C1.
What is the InChIKey of (2-oxopropylamino) 3,3,5-trimethylcyclohexane-1-carboxylate?
The InChIKey is RRAULEQFQVXKAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO3/c1-9-5-11(7-13(3,4)6-9)12(16)17-14-8-10(2)15/h9,11,14H,5-8H2,1-4H3.
What are the key properties of (2-oxopropylamino) 3,3,5-trimethylcyclohexane-1-carboxylate?
(2-oxopropylamino) 3,3,5-trimethylcyclohexane-1-carboxylate has a molecular weight of 241.33 g/mol, XLogP of 2.09, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxopropylamino) 3,3,5-trimethylcyclohexane-1-carboxylate is sourced from PubChem (CID 56606267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).