C25H40O — CID 56606419
(2S,4aR,6R,8aS)-2-butoxy-6-(4-pentylphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 56606419) has the molecular formula C25H40O and a molecular weight of 356.59 g/mol. Its IUPAC name is (2S,4aR,6R,8aS)-2-butoxy-6-(4-pentylphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2S,4aR,6R,8aS)-2-butoxy-6-(4-pentylphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 56606419 |
| Molecular Formula | C25H40O |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 356.31 |
| IUPAC Name | (2S,4aR,6R,8aS)-2-butoxy-6-(4-pentylphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCCc1ccc([C@@H]2CC[C@H]3C[C@@H](OCCCC)CC[C@@H]3C2)cc1 |
| InChI | InChI=1S/C25H40O/c1-3-5-7-8-20-9-11-21(12-10-20)22-13-14-24-19-25(26-17-6-4-2)16-15-23(24)18-22/h9-12,22-25H,3-8,13-19H2,1-2H3/t22-,23-,24+,25+/m1/s1 |
| InChIKey | RFQQHPYPNWBMCJ-NGSHPTGOSA-N |
| XLogP | 7.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|