C26H10N2O4 — CID 56606601
8,21-diazaoctacyclo[21.3.1.110,14.03,12.06,11.013,26.016,25.019,24]octacosa-1(26),2,4,6(11),10(28),12,14,16(25),17,19(24),23(27)-undecaene-7,9,20,22-tetrone (PubChem CID 56606601) has the molecular formula C26H10N2O4 and a molecular weight of 414.38 g/mol. Its IUPAC name is 8,21-diazaoctacyclo[21.3.1.110,14.03,12.06,11.013,26.016,25.019,24]octacosa-1(26),2,4,6(11),10(28),12,14,16(25),17,19(24),23(27)-undecaene-7,9,20,22-tetrone.
| Compound Name | 8,21-diazaoctacyclo[21.3.1.110,14.03,12.06,11.013,26.016,25.019,24]octacosa-1(26),2,4,6(11),10(28),12,14,16(25),17,19(24),23(27)-undecaene-7,9,20,22-tetrone |
|---|---|
| PubChem CID | 56606601 |
| Molecular Formula | C26H10N2O4 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 8,21-diazaoctacyclo[21.3.1.110,14.03,12.06,11.013,26.016,25.019,24]octacosa-1(26),2,4,6(11),10(28),12,14,16(25),17,19(24),23(27)-undecaene-7,9,20,22-tetrone |
| SMILES | O=c1[nH]c(=O)c2cc3cc4ccc5c(=O)[nH]c(=O)c6cc7cc8ccc1c2c8c3c7c4c56 |
| InChI | InChI=1S/C26H10N2O4/c29-23-13-3-1-9-5-11-7-16-22-14(24(30)28-26(16)32)4-2-10-6-12-8-15(25(31)27-23)21(13)17(9)19(12)20(11)18(10)22/h1-8H,(H,27,29,31)(H,28,30,32) |
| InChIKey | DPCCDURKWAUCOW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|