C27H42O2 — CID 566071
10,13-dimethyl-17-(6-methylheptan-2-yl)-2,4,7,8,9,11,12,14,15,17-decahydro-1H-cyclopenta[a]phenanthrene-3,16-dione (PubChem CID 566071) has the molecular formula C27H42O2 and a molecular weight of 398.63 g/mol. Its IUPAC name is 10,13-dimethyl-17-(6-methylheptan-2-yl)-2,4,7,8,9,11,12,14,15,17-decahydro-1H-cyclopenta[a]phenanthrene-3,16-dione.
| Compound Name | 10,13-dimethyl-17-(6-methylheptan-2-yl)-2,4,7,8,9,11,12,14,15,17-decahydro-1H-cyclopenta[a]phenanthrene-3,16-dione |
|---|---|
| PubChem CID | 566071 |
| Molecular Formula | C27H42O2 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.32 |
| IUPAC Name | 10,13-dimethyl-17-(6-methylheptan-2-yl)-2,4,7,8,9,11,12,14,15,17-decahydro-1H-cyclopenta[a]phenanthrene-3,16-dione |
| SMILES | CC(C)CCCC(C)C1C(=O)CC2C3CC=C4CC(=O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C27H42O2/c1-17(2)7-6-8-18(3)25-24(29)16-23-21-10-9-19-15-20(28)11-13-26(19,4)22(21)12-14-27(23,25)5/h9,17-18,21-23,25H,6-8,10-16H2,1-5H3 |
| InChIKey | ITUFROVSFDLLJK-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|