C18H16N2O4S — CID 56607136
N-(4-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl)-2-methyl-4-oxo-3H-1,2-benzothiazine-3-carboxamide (PubChem CID 56607136) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is N-(4-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl)-2-methyl-4-oxo-3H-1,2-benzothiazine-3-carboxamide.
| Compound Name | N-(4-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl)-2-methyl-4-oxo-3H-1,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 56607136 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | N-(4-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl)-2-methyl-4-oxo-3H-1,2-benzothiazine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)C2C(=O)c3ccccc3SN2C)c(=O)cc1 |
| InChI | InChI=1S/C18H16N2O4S/c1-20-16(17(22)12-5-3-4-6-15(12)25-20)18(23)19-13-9-7-11(24-2)8-10-14(13)21/h3-10,16H,1-2H3,(H,19,21,23) |
| InChIKey | OVNNPMUSLUPDEO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|