C3H5Cl3O4S2 — CID 56607494
3-chloropropane-1,2-disulfonyl chloride (PubChem CID 56607494) has the molecular formula C3H5Cl3O4S2 and a molecular weight of 275.56 g/mol. Its IUPAC name is 3-chloropropane-1,2-disulfonyl chloride.
| Compound Name | 3-chloropropane-1,2-disulfonyl chloride |
|---|---|
| PubChem CID | 56607494 |
| Molecular Formula | C3H5Cl3O4S2 |
| Molecular Weight | 275.56 g/mol |
| Exact Mass | 273.87 |
| IUPAC Name | 3-chloropropane-1,2-disulfonyl chloride |
| SMILES | O=S(=O)(Cl)CC(CCl)S(=O)(=O)Cl |
| InChI | InChI=1S/C3H5Cl3O4S2/c4-1-3(12(6,9)10)2-11(5,7)8/h3H,1-2H2 |
| InChIKey | VUJVYUJUMAYKFW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.56 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|