C11H14N6O5S — CID 56607729
(2S,4S,5R,6R)-3,3-dimethyl-4,7-dioxo-6-[[2-(tetrazol-1-yl)acetyl]amino]-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 56607729) has the molecular formula C11H14N6O5S and a molecular weight of 342.34 g/mol. Its IUPAC name is (2S,4S,5R,6R)-3,3-dimethyl-4,7-dioxo-6-[[2-(tetrazol-1-yl)acetyl]amino]-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,4S,5R,6R)-3,3-dimethyl-4,7-dioxo-6-[[2-(tetrazol-1-yl)acetyl]amino]-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 56607729 |
| Molecular Formula | C11H14N6O5S |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | (2S,4S,5R,6R)-3,3-dimethyl-4,7-dioxo-6-[[2-(tetrazol-1-yl)acetyl]amino]-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)[C@H](C(=O)O)N2C(=O)[C@@H](NC(=O)Cn3cnnn3)[C@H]2[S@]1=O |
| InChI | InChI=1S/C11H14N6O5S/c1-11(2)7(10(20)21)17-8(19)6(9(17)23(11)22)13-5(18)3-16-4-12-14-15-16/h4,6-7,9H,3H2,1-2H3,(H,13,18)(H,20,21)/t6-,7+,9-,23-/m1/s1 |
| InChIKey | GOCBBHVGGUFCQS-ITSWYCCDSA-N |
| XLogP | -2.68 |
| TPSA | 147.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |