About 1-pentylideneguanidine
1-pentylideneguanidine (PubChem CID 56608064) has the molecular formula C6H13N3
and a molecular weight of 127.19 g/mol. Its IUPAC name is 1-pentylideneguanidine.
Molecular Properties
| Compound Name | 1-pentylideneguanidine |
| PubChem CID | 56608064 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | 1-pentylideneguanidine |
| SMILES | [H]/N=C(\N)N=CCCCC |
| InChI | InChI=1S/C6H13N3/c1-2-3-4-5-9-6(7)8/h5H,2-4H2,1H3,(H3,7,8) |
| InChIKey | RNYVFMBABMBTAM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-pentylideneguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentylideneguanidine?
The IUPAC name of 1-pentylideneguanidine (CID 56608064) is 1-pentylideneguanidine.
What is the SMILES notation for 1-pentylideneguanidine?
The canonical SMILES for 1-pentylideneguanidine is [H]/N=C(\N)N=CCCCC.
What is the InChIKey of 1-pentylideneguanidine?
The InChIKey is RNYVFMBABMBTAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3/c1-2-3-4-5-9-6(7)8/h5H,2-4H2,1H3,(H3,7,8).
What are the key properties of 1-pentylideneguanidine?
1-pentylideneguanidine has a molecular weight of 127.19 g/mol, XLogP of 1.14, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentylideneguanidine is sourced from PubChem (CID 56608064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).