C24H12N6O4 — CID 56608351
5-amino-2-[2-(4-amino-2-cyanophenyl)-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]benzonitrile (PubChem CID 56608351) has the molecular formula C24H12N6O4 and a molecular weight of 448.40 g/mol. Its IUPAC name is 5-amino-2-[2-(4-amino-2-cyanophenyl)-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]benzonitrile.
| Compound Name | 5-amino-2-[2-(4-amino-2-cyanophenyl)-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]benzonitrile |
|---|---|
| PubChem CID | 56608351 |
| Molecular Formula | C24H12N6O4 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 5-amino-2-[2-(4-amino-2-cyanophenyl)-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]benzonitrile |
| SMILES | N#Cc1cc(N)ccc1-n1c(=O)c2cc3c(=O)n(-c4ccc(N)cc4C#N)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C24H12N6O4/c25-9-11-5-13(27)1-3-19(11)29-21(31)15-7-17-18(8-16(15)22(29)32)24(34)30(23(17)33)20-4-2-14(28)6-12(20)10-26/h1-8H,27-28H2 |
| InChIKey | HCGANWDXXRVDEJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 177.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|