About [4-[4-[(2R)-2-fluoropropanoyl]oxycyclohexyl]cyclohexyl] (2R)-2-fluoropropanoate
[4-[4-[(2R)-2-fluoropropanoyl]oxycyclohexyl]cyclohexyl] (2R)-2-fluoropropanoate (PubChem CID 56608480) has the molecular formula C18H28F2O4
and a molecular weight of 346.41 g/mol. Its IUPAC name is [4-[4-[(2R)-2-fluoropropanoyl]oxycyclohexyl]cyclohexyl] (2R)-2-fluoropropanoate.
Molecular Properties
| Compound Name | [4-[4-[(2R)-2-fluoropropanoyl]oxycyclohexyl]cyclohexyl] (2R)-2-fluoropropanoate |
| PubChem CID | 56608480 |
| Molecular Formula | C18H28F2O4 |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | [4-[4-[(2R)-2-fluoropropanoyl]oxycyclohexyl]cyclohexyl] (2R)-2-fluoropropanoate |
| SMILES | C[C@@H](F)C(=O)OC1CCC(C2CCC(OC(=O)[C@@H](C)F)CC2)CC1 |
| InChI | InChI=1S/C18H28F2O4/c1-11(19)17(21)23-15-7-3-13(4-8-15)14-5-9-16(10-6-14)24-18(22)12(2)20/h11-16H,3-10H2,1-2H3/t11-,12-,13?,14?,15?,16?/m1/s1 |
| InChIKey | FQNQLLFWKMIBAY-YLCQGBONSA-N |
| XLogP | 3.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[4-[(2R)-2-fluoropropanoyl]oxycyclohexyl]cyclohexyl] (2R)-2-fluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-[(2R)-2-fluoropropanoyl]oxycyclohexyl]cyclohexyl] (2R)-2-fluoropropanoate?
The IUPAC name of [4-[4-[(2R)-2-fluoropropanoyl]oxycyclohexyl]cyclohexyl] (2R)-2-fluoropropanoate (CID 56608480) is [4-[4-[(2R)-2-fluoropropanoyl]oxycyclohexyl]cyclohexyl] (2R)-2-fluoropropanoate.
What is the SMILES notation for [4-[4-[(2R)-2-fluoropropanoyl]oxycyclohexyl]cyclohexyl] (2R)-2-fluoropropanoate?
The canonical SMILES for [4-[4-[(2R)-2-fluoropropanoyl]oxycyclohexyl]cyclohexyl] (2R)-2-fluoropropanoate is C[C@@H](F)C(=O)OC1CCC(C2CCC(OC(=O)[C@@H](C)F)CC2)CC1.
What is the InChIKey of [4-[4-[(2R)-2-fluoropropanoyl]oxycyclohexyl]cyclohexyl] (2R)-2-fluoropropanoate?
The InChIKey is FQNQLLFWKMIBAY-YLCQGBONSA-N. The full InChI is InChI=1S/C18H28F2O4/c1-11(19)17(21)23-15-7-3-13(4-8-15)14-5-9-16(10-6-14)24-18(22)12(2)20/h11-16H,3-10H2,1-2H3/t11-,12-,13?,14?,15?,16?/m1/s1.
What are the key properties of [4-[4-[(2R)-2-fluoropropanoyl]oxycyclohexyl]cyclohexyl] (2R)-2-fluoropropanoate?
[4-[4-[(2R)-2-fluoropropanoyl]oxycyclohexyl]cyclohexyl] (2R)-2-fluoropropanoate has a molecular weight of 346.41 g/mol, XLogP of 3.91, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-[(2R)-2-fluoropropanoyl]oxycyclohexyl]cyclohexyl] (2R)-2-fluoropropanoate is sourced from PubChem (CID 56608480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).