About 7-(dimethylamino)-3,4,5-trimethyl-6H-quinolin-2-one
7-(dimethylamino)-3,4,5-trimethyl-6H-quinolin-2-one (PubChem CID 56608534) has the molecular formula C14H18N2O
and a molecular weight of 230.31 g/mol. Its IUPAC name is 7-(dimethylamino)-3,4,5-trimethyl-6H-quinolin-2-one.
Molecular Properties
| Compound Name | 7-(dimethylamino)-3,4,5-trimethyl-6H-quinolin-2-one |
| PubChem CID | 56608534 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 7-(dimethylamino)-3,4,5-trimethyl-6H-quinolin-2-one |
| SMILES | CC1=C2C(=NC(=O)C(C)=C2C)C=C(N(C)C)C1 |
| InChI | InChI=1S/C14H18N2O/c1-8-6-11(16(4)5)7-12-13(8)9(2)10(3)14(17)15-12/h7H,6H2,1-5H3 |
| InChIKey | RMQUBCMLGOJNIO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(dimethylamino)-3,4,5-trimethyl-6H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(dimethylamino)-3,4,5-trimethyl-6H-quinolin-2-one?
The IUPAC name of 7-(dimethylamino)-3,4,5-trimethyl-6H-quinolin-2-one (CID 56608534) is 7-(dimethylamino)-3,4,5-trimethyl-6H-quinolin-2-one.
What is the SMILES notation for 7-(dimethylamino)-3,4,5-trimethyl-6H-quinolin-2-one?
The canonical SMILES for 7-(dimethylamino)-3,4,5-trimethyl-6H-quinolin-2-one is CC1=C2C(=NC(=O)C(C)=C2C)C=C(N(C)C)C1.
What is the InChIKey of 7-(dimethylamino)-3,4,5-trimethyl-6H-quinolin-2-one?
The InChIKey is RMQUBCMLGOJNIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O/c1-8-6-11(16(4)5)7-12-13(8)9(2)10(3)14(17)15-12/h7H,6H2,1-5H3.
What are the key properties of 7-(dimethylamino)-3,4,5-trimethyl-6H-quinolin-2-one?
7-(dimethylamino)-3,4,5-trimethyl-6H-quinolin-2-one has a molecular weight of 230.31 g/mol, XLogP of 2.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(dimethylamino)-3,4,5-trimethyl-6H-quinolin-2-one is sourced from PubChem (CID 56608534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).