About 3-O-ethoxycarbonyl 2-O-(3-methyl-3-propan-2-ylcyclohexyl) 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate
3-O-ethoxycarbonyl 2-O-(3-methyl-3-propan-2-ylcyclohexyl) 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 56608640) has the molecular formula C21H32O7
and a molecular weight of 396.48 g/mol. Its IUPAC name is 3-O-ethoxycarbonyl 2-O-(3-methyl-3-propan-2-ylcyclohexyl) 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate.
Molecular Properties
| Compound Name | 3-O-ethoxycarbonyl 2-O-(3-methyl-3-propan-2-ylcyclohexyl) 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| PubChem CID | 56608640 |
| Molecular Formula | C21H32O7 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 3-O-ethoxycarbonyl 2-O-(3-methyl-3-propan-2-ylcyclohexyl) 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | CCOC(=O)OC(=O)C1C2CCC(O2)C1C(=O)OC1CCCC(C)(C(C)C)C1 |
| InChI | InChI=1S/C21H32O7/c1-5-25-20(24)28-19(23)17-15-9-8-14(27-15)16(17)18(22)26-13-7-6-10-21(4,11-13)12(2)3/h12-17H,5-11H2,1-4H3 |
| InChIKey | LWLSDYYRRJTTFI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-O-ethoxycarbonyl 2-O-(3-methyl-3-propan-2-ylcyclohexyl) 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-ethoxycarbonyl 2-O-(3-methyl-3-propan-2-ylcyclohexyl) 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate?
The IUPAC name of 3-O-ethoxycarbonyl 2-O-(3-methyl-3-propan-2-ylcyclohexyl) 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate (CID 56608640) is 3-O-ethoxycarbonyl 2-O-(3-methyl-3-propan-2-ylcyclohexyl) 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate.
What is the SMILES notation for 3-O-ethoxycarbonyl 2-O-(3-methyl-3-propan-2-ylcyclohexyl) 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate?
The canonical SMILES for 3-O-ethoxycarbonyl 2-O-(3-methyl-3-propan-2-ylcyclohexyl) 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate is CCOC(=O)OC(=O)C1C2CCC(O2)C1C(=O)OC1CCCC(C)(C(C)C)C1.
What is the InChIKey of 3-O-ethoxycarbonyl 2-O-(3-methyl-3-propan-2-ylcyclohexyl) 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate?
The InChIKey is LWLSDYYRRJTTFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32O7/c1-5-25-20(24)28-19(23)17-15-9-8-14(27-15)16(17)18(22)26-13-7-6-10-21(4,11-13)12(2)3/h12-17H,5-11H2,1-4H3.
What are the key properties of 3-O-ethoxycarbonyl 2-O-(3-methyl-3-propan-2-ylcyclohexyl) 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate?
3-O-ethoxycarbonyl 2-O-(3-methyl-3-propan-2-ylcyclohexyl) 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate has a molecular weight of 396.48 g/mol, XLogP of 3.63, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-ethoxycarbonyl 2-O-(3-methyl-3-propan-2-ylcyclohexyl) 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate is sourced from PubChem (CID 56608640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).