C15H26O6 — CID 56609033
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(3,5,5-trimethylcyclohex-3-en-1-yl)oxyoxane-3,4,5-triol (PubChem CID 56609033) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(3,5,5-trimethylcyclohex-3-en-1-yl)oxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(3,5,5-trimethylcyclohex-3-en-1-yl)oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 56609033 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(3,5,5-trimethylcyclohex-3-en-1-yl)oxyoxane-3,4,5-triol |
| SMILES | CC1=CC(C)(C)CC(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C1 |
| InChI | InChI=1S/C15H26O6/c1-8-4-9(6-15(2,3)5-8)20-14-13(19)12(18)11(17)10(7-16)21-14/h5,9-14,16-19H,4,6-7H2,1-3H3/t9?,10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | SPLHUKKVCRLTNG-MXNNCRBYSA-N |
| XLogP | -0.06 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|