C18H27F3O3 — CID 56609136
5-hexyl-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane (PubChem CID 56609136) has the molecular formula C18H27F3O3 and a molecular weight of 348.41 g/mol. Its IUPAC name is 5-hexyl-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane.
| Compound Name | 5-hexyl-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 56609136 |
| Molecular Formula | C18H27F3O3 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 5-hexyl-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane |
| SMILES | CCCCCCC1COC(C2=CCC(OCC(F)(F)F)C=C2)OC1 |
| InChI | InChI=1S/C18H27F3O3/c1-2-3-4-5-6-14-11-22-17(23-12-14)15-7-9-16(10-8-15)24-13-18(19,20)21/h7-9,14,16-17H,2-6,10-13H2,1H3 |
| InChIKey | IPYKMZAZEQWTPL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|