C19H27F5O3 — CID 56609363
5-hexyl-2-[4-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane (PubChem CID 56609363) has the molecular formula C19H27F5O3 and a molecular weight of 398.41 g/mol. Its IUPAC name is 5-hexyl-2-[4-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane.
| Compound Name | 5-hexyl-2-[4-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 56609363 |
| Molecular Formula | C19H27F5O3 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 5-hexyl-2-[4-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane |
| SMILES | CCCCCCC1COC(C2=CCC(OC(F)(F)C(F)(F)CF)C=C2)OC1 |
| InChI | InChI=1S/C19H27F5O3/c1-2-3-4-5-6-14-11-25-17(26-12-14)15-7-9-16(10-8-15)27-19(23,24)18(21,22)13-20/h7-9,14,16-17H,2-6,10-13H2,1H3 |
| InChIKey | NRKZATGLONFTPC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|