C24H36N6O4S — CID 56609390
3-[(3aS,4R,6R,6aR)-4-[7-(butylamino)-5-pentylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]prop-2-enoic acid (PubChem CID 56609390) has the molecular formula C24H36N6O4S and a molecular weight of 504.66 g/mol. Its IUPAC name is 3-[(3aS,4R,6R,6aR)-4-[7-(butylamino)-5-pentylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]prop-2-enoic acid.
| Compound Name | 3-[(3aS,4R,6R,6aR)-4-[7-(butylamino)-5-pentylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 56609390 |
| Molecular Formula | C24H36N6O4S |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 3-[(3aS,4R,6R,6aR)-4-[7-(butylamino)-5-pentylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]prop-2-enoic acid |
| SMILES | CCCCCSc1nc(NCCCC)c2nnn([C@@H]3C[C@H](C=CC(=O)O)[C@H]4OC(C)(C)O[C@H]43)c2n1 |
| InChI | InChI=1S/C24H36N6O4S/c1-5-7-9-13-35-23-26-21(25-12-8-6-2)18-22(27-23)30(29-28-18)16-14-15(10-11-17(31)32)19-20(16)34-24(3,4)33-19/h10-11,15-16,19-20H,5-9,12-14H2,1-4H3,(H,31,32)(H,25,26,27)/t15-,16+,19+,20-/m0/s1 |
| InChIKey | IRKZGGOUEKYPNJ-FIYPYCPBSA-N |
| XLogP | 4.44 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|