C24H27NO5 — CID 56609441
(3aR,5R,6S,6aR)-5-[(1R)-2-isocyano-1-phenylmethoxyethyl]-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 56609441) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-5-[(1R)-2-isocyano-1-phenylmethoxyethyl]-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-5-[(1R)-2-isocyano-1-phenylmethoxyethyl]-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 56609441 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | (3aR,5R,6S,6aR)-5-[(1R)-2-isocyano-1-phenylmethoxyethyl]-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | [C-]#[N+]C[C@@H](OCc1ccccc1)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C24H27NO5/c1-24(2)29-22-21(27-16-18-12-8-5-9-13-18)20(28-23(22)30-24)19(14-25-3)26-15-17-10-6-4-7-11-17/h4-13,19-23H,14-16H2,1-2H3/t19-,20-,21+,22-,23-/m1/s1 |
| InChIKey | XINIPQGEXDWSKJ-XNBWIAOKSA-N |
| XLogP | 3.95 |
| TPSA | 50.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|