C11H16N2O5 — CID 56609839
4-(5-ethyl-2,4,6-trioxo-1,3-diazinan-5-yl)-2-methylbutanoic acid (PubChem CID 56609839) has the molecular formula C11H16N2O5 and a molecular weight of 256.26 g/mol. Its IUPAC name is 4-(5-ethyl-2,4,6-trioxo-1,3-diazinan-5-yl)-2-methylbutanoic acid.
| Compound Name | 4-(5-ethyl-2,4,6-trioxo-1,3-diazinan-5-yl)-2-methylbutanoic acid |
|---|---|
| PubChem CID | 56609839 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 4-(5-ethyl-2,4,6-trioxo-1,3-diazinan-5-yl)-2-methylbutanoic acid |
| SMILES | CCC1(CCC(C)C(=O)O)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C11H16N2O5/c1-3-11(5-4-6(2)7(14)15)8(16)12-10(18)13-9(11)17/h6H,3-5H2,1-2H3,(H,14,15)(H2,12,13,16,17,18) |
| InChIKey | MFHCTDYNXLDGRU-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|