C8H14F3NO — CID 56609959
1-[(1S)-1-amino-2,2,2-trifluoroethyl]cyclohexan-1-ol (PubChem CID 56609959) has the molecular formula C8H14F3NO and a molecular weight of 197.20 g/mol. Its IUPAC name is 1-[(1S)-1-amino-2,2,2-trifluoroethyl]cyclohexan-1-ol.
| Compound Name | 1-[(1S)-1-amino-2,2,2-trifluoroethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 56609959 |
| Molecular Formula | C8H14F3NO |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 1-[(1S)-1-amino-2,2,2-trifluoroethyl]cyclohexan-1-ol |
| SMILES | N[C@H](C(F)(F)F)C1(O)CCCCC1 |
| InChI | InChI=1S/C8H14F3NO/c9-8(10,11)6(12)7(13)4-2-1-3-5-7/h6,13H,1-5,12H2/t6-/m0/s1 |
| InChIKey | IXCBRJSZPBNNRJ-LURJTMIESA-N |
| XLogP | 1.57 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |