C13H20O4Si — CID 56609974
methyl (1R,2S,6S)-2-hydroxy-1-(2-trimethylsilylethynyl)-7-oxabicyclo[4.1.0]heptane-2-carboxylate (PubChem CID 56609974) has the molecular formula C13H20O4Si and a molecular weight of 268.38 g/mol. Its IUPAC name is methyl (1R,2S,6S)-2-hydroxy-1-(2-trimethylsilylethynyl)-7-oxabicyclo[4.1.0]heptane-2-carboxylate.
| Compound Name | methyl (1R,2S,6S)-2-hydroxy-1-(2-trimethylsilylethynyl)-7-oxabicyclo[4.1.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 56609974 |
| Molecular Formula | C13H20O4Si |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | methyl (1R,2S,6S)-2-hydroxy-1-(2-trimethylsilylethynyl)-7-oxabicyclo[4.1.0]heptane-2-carboxylate |
| SMILES | COC(=O)[C@]1(O)CCC[C@@H]2O[C@]21C#C[Si](C)(C)C |
| InChI | InChI=1S/C13H20O4Si/c1-16-11(14)12(15)7-5-6-10-13(12,17-10)8-9-18(2,3)4/h10,15H,5-7H2,1-4H3/t10-,12+,13+/m0/s1 |
| InChIKey | JAPNMKRPYVUKQH-CYZMBNFOSA-N |
| XLogP | 1.09 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|