About 2-(3-methyl-1,2-oxazol-5-yl)morpholine
2-(3-methyl-1,2-oxazol-5-yl)morpholine (PubChem CID 56610453) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 2-(3-methyl-1,2-oxazol-5-yl)morpholine.
Molecular Properties
| Compound Name | 2-(3-methyl-1,2-oxazol-5-yl)morpholine |
| PubChem CID | 56610453 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 2-(3-methyl-1,2-oxazol-5-yl)morpholine |
| SMILES | Cc1cc(C2CNCCO2)on1 |
| InChI | InChI=1S/C8H12N2O2/c1-6-4-7(12-10-6)8-5-9-2-3-11-8/h4,8-9H,2-3,5H2,1H3 |
| InChIKey | IEPMBXMCDYITET-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-methyl-1,2-oxazol-5-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-1,2-oxazol-5-yl)morpholine?
The IUPAC name of 2-(3-methyl-1,2-oxazol-5-yl)morpholine (CID 56610453) is 2-(3-methyl-1,2-oxazol-5-yl)morpholine.
What is the SMILES notation for 2-(3-methyl-1,2-oxazol-5-yl)morpholine?
The canonical SMILES for 2-(3-methyl-1,2-oxazol-5-yl)morpholine is Cc1cc(C2CNCCO2)on1.
What is the InChIKey of 2-(3-methyl-1,2-oxazol-5-yl)morpholine?
The InChIKey is IEPMBXMCDYITET-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-6-4-7(12-10-6)8-5-9-2-3-11-8/h4,8-9H,2-3,5H2,1H3.
What are the key properties of 2-(3-methyl-1,2-oxazol-5-yl)morpholine?
2-(3-methyl-1,2-oxazol-5-yl)morpholine has a molecular weight of 168.20 g/mol, XLogP of 0.64, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-1,2-oxazol-5-yl)morpholine is sourced from PubChem (CID 56610453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).