C12H16F2O8 — CID 56610536
[(2R,3S,4S,5R)-3,4-diacetyloxy-5,6-difluoro-1-hydroxy-6-oxohexan-2-yl] acetate (PubChem CID 56610536) has the molecular formula C12H16F2O8 and a molecular weight of 326.25 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4-diacetyloxy-5,6-difluoro-1-hydroxy-6-oxohexan-2-yl] acetate.
| Compound Name | [(2R,3S,4S,5R)-3,4-diacetyloxy-5,6-difluoro-1-hydroxy-6-oxohexan-2-yl] acetate |
|---|---|
| PubChem CID | 56610536 |
| Molecular Formula | C12H16F2O8 |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4-diacetyloxy-5,6-difluoro-1-hydroxy-6-oxohexan-2-yl] acetate |
| SMILES | CC(=O)O[C@H]([C@H](OC(C)=O)[C@@H](F)C(=O)F)[C@@H](CO)OC(C)=O |
| InChI | InChI=1S/C12H16F2O8/c1-5(16)20-8(4-15)10(21-6(2)17)11(22-7(3)18)9(13)12(14)19/h8-11,15H,4H2,1-3H3/t8-,9-,10+,11-/m1/s1 |
| InChIKey | ULCDOYHIOJWFDG-CHWFTXMASA-N |
| XLogP | -0.39 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|