C24H44N4O2 — CID 56610929
3-hydroxy-2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-4-(1,2,2,6,6-pentamethylpiperidin-4-yl)iminocyclobutan-1-one (PubChem CID 56610929) has the molecular formula C24H44N4O2 and a molecular weight of 420.64 g/mol. Its IUPAC name is 3-hydroxy-2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-4-(1,2,2,6,6-pentamethylpiperidin-4-yl)iminocyclobutan-1-one.
| Compound Name | 3-hydroxy-2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-4-(1,2,2,6,6-pentamethylpiperidin-4-yl)iminocyclobutan-1-one |
|---|---|
| PubChem CID | 56610929 |
| Molecular Formula | C24H44N4O2 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.35 |
| IUPAC Name | 3-hydroxy-2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-4-(1,2,2,6,6-pentamethylpiperidin-4-yl)iminocyclobutan-1-one |
| SMILES | CN1C(C)(C)CC(/N=C2\C(=O)C(NC3CC(C)(C)N(C)C(C)(C)C3)C2O)CC1(C)C |
| InChI | InChI=1S/C24H44N4O2/c1-21(2)11-15(12-22(3,4)27(21)9)25-17-19(29)18(20(17)30)26-16-13-23(5,6)28(10)24(7,8)14-16/h15-17,19,25,29H,11-14H2,1-10H3/b26-18- |
| InChIKey | SUFKMSZPNLYKGC-ITYLOYPMSA-N |
| XLogP | 2.63 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|