About 1-[butan-2-ylsulfanyl(ethoxy)phosphoryl]-4-hydroxy-3,5-dimethylimidazol-2-one
1-[butan-2-ylsulfanyl(ethoxy)phosphoryl]-4-hydroxy-3,5-dimethylimidazol-2-one (PubChem CID 56611057) has the molecular formula C11H21N2O4PS
and a molecular weight of 308.34 g/mol. Its IUPAC name is 1-[butan-2-ylsulfanyl(ethoxy)phosphoryl]-4-hydroxy-3,5-dimethylimidazol-2-one.
Molecular Properties
| Compound Name | 1-[butan-2-ylsulfanyl(ethoxy)phosphoryl]-4-hydroxy-3,5-dimethylimidazol-2-one |
| PubChem CID | 56611057 |
| Molecular Formula | C11H21N2O4PS |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-[butan-2-ylsulfanyl(ethoxy)phosphoryl]-4-hydroxy-3,5-dimethylimidazol-2-one |
| SMILES | CCOP(=O)(SC(C)CC)n1c(C)c(O)n(C)c1=O |
| InChI | InChI=1S/C11H21N2O4PS/c1-6-8(3)19-18(16,17-7-2)13-9(4)10(14)12(5)11(13)15/h8,14H,6-7H2,1-5H3 |
| InChIKey | JKLPWOMVIBLIEC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 73.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[butan-2-ylsulfanyl(ethoxy)phosphoryl]-4-hydroxy-3,5-dimethylimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[butan-2-ylsulfanyl(ethoxy)phosphoryl]-4-hydroxy-3,5-dimethylimidazol-2-one?
The IUPAC name of 1-[butan-2-ylsulfanyl(ethoxy)phosphoryl]-4-hydroxy-3,5-dimethylimidazol-2-one (CID 56611057) is 1-[butan-2-ylsulfanyl(ethoxy)phosphoryl]-4-hydroxy-3,5-dimethylimidazol-2-one.
What is the SMILES notation for 1-[butan-2-ylsulfanyl(ethoxy)phosphoryl]-4-hydroxy-3,5-dimethylimidazol-2-one?
The canonical SMILES for 1-[butan-2-ylsulfanyl(ethoxy)phosphoryl]-4-hydroxy-3,5-dimethylimidazol-2-one is CCOP(=O)(SC(C)CC)n1c(C)c(O)n(C)c1=O.
What is the InChIKey of 1-[butan-2-ylsulfanyl(ethoxy)phosphoryl]-4-hydroxy-3,5-dimethylimidazol-2-one?
The InChIKey is JKLPWOMVIBLIEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N2O4PS/c1-6-8(3)19-18(16,17-7-2)13-9(4)10(14)12(5)11(13)15/h8,14H,6-7H2,1-5H3.
What are the key properties of 1-[butan-2-ylsulfanyl(ethoxy)phosphoryl]-4-hydroxy-3,5-dimethylimidazol-2-one?
1-[butan-2-ylsulfanyl(ethoxy)phosphoryl]-4-hydroxy-3,5-dimethylimidazol-2-one has a molecular weight of 308.34 g/mol, XLogP of 2.73, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[butan-2-ylsulfanyl(ethoxy)phosphoryl]-4-hydroxy-3,5-dimethylimidazol-2-one is sourced from PubChem (CID 56611057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).