C15H20N2O2 — CID 56611195
1-[(5-phenyl-2,5-dihydro-1,2-oxazol-3-yl)methyl]piperidin-4-ol (PubChem CID 56611195) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-[(5-phenyl-2,5-dihydro-1,2-oxazol-3-yl)methyl]piperidin-4-ol.
| Compound Name | 1-[(5-phenyl-2,5-dihydro-1,2-oxazol-3-yl)methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 56611195 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 1-[(5-phenyl-2,5-dihydro-1,2-oxazol-3-yl)methyl]piperidin-4-ol |
| SMILES | OC1CCN(CC2=CC(c3ccccc3)ON2)CC1 |
| InChI | InChI=1S/C15H20N2O2/c18-14-6-8-17(9-7-14)11-13-10-15(19-16-13)12-4-2-1-3-5-12/h1-5,10,14-16,18H,6-9,11H2 |
| InChIKey | FXMHONMYINRHPY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |