C19H23F9O — CID 56611209
2-(4-ethylcyclohexyl)-5-(1,1,2,2,3,3,4,4,5-nonafluoropentoxy)cyclohexa-1,3-diene (PubChem CID 56611209) has the molecular formula C19H23F9O and a molecular weight of 438.37 g/mol. Its IUPAC name is 2-(4-ethylcyclohexyl)-5-(1,1,2,2,3,3,4,4,5-nonafluoropentoxy)cyclohexa-1,3-diene.
| Compound Name | 2-(4-ethylcyclohexyl)-5-(1,1,2,2,3,3,4,4,5-nonafluoropentoxy)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 56611209 |
| Molecular Formula | C19H23F9O |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 2-(4-ethylcyclohexyl)-5-(1,1,2,2,3,3,4,4,5-nonafluoropentoxy)cyclohexa-1,3-diene |
| SMILES | CCC1CCC(C2=CCC(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)CF)C=C2)CC1 |
| InChI | InChI=1S/C19H23F9O/c1-2-12-3-5-13(6-4-12)14-7-9-15(10-8-14)29-19(27,28)18(25,26)17(23,24)16(21,22)11-20/h7-9,12-13,15H,2-6,10-11H2,1H3 |
| InChIKey | HFBOKTBCRDNTLS-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|