C17H14N2O4S — CID 56611242
N-(2-hydroxy-3-oxocyclohepta-1,4,6-trien-1-yl)-2-methyl-4-oxo-3H-1,2-benzothiazine-3-carboxamide (PubChem CID 56611242) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is N-(2-hydroxy-3-oxocyclohepta-1,4,6-trien-1-yl)-2-methyl-4-oxo-3H-1,2-benzothiazine-3-carboxamide.
| Compound Name | N-(2-hydroxy-3-oxocyclohepta-1,4,6-trien-1-yl)-2-methyl-4-oxo-3H-1,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 56611242 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | N-(2-hydroxy-3-oxocyclohepta-1,4,6-trien-1-yl)-2-methyl-4-oxo-3H-1,2-benzothiazine-3-carboxamide |
| SMILES | CN1Sc2ccccc2C(=O)C1C(=O)Nc1ccccc(=O)c1O |
| InChI | InChI=1S/C17H14N2O4S/c1-19-14(15(21)10-6-2-5-9-13(10)24-19)17(23)18-11-7-3-4-8-12(20)16(11)22/h2-9,14H,1H3,(H2,18,20,22,23) |
| InChIKey | ZCRFYKINNMXPFI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|