About N-(1,1-dioxothian-4-yl)-1-piperidin-1-ylethane-1,2-diamine
N-(1,1-dioxothian-4-yl)-1-piperidin-1-ylethane-1,2-diamine (PubChem CID 56611280) has the molecular formula C12H25N3O2S
and a molecular weight of 275.42 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-1-piperidin-1-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(1,1-dioxothian-4-yl)-1-piperidin-1-ylethane-1,2-diamine |
| PubChem CID | 56611280 |
| Molecular Formula | C12H25N3O2S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-1-piperidin-1-ylethane-1,2-diamine |
| SMILES | NCC(NC1CCS(=O)(=O)CC1)N1CCCCC1 |
| InChI | InChI=1S/C12H25N3O2S/c13-10-12(15-6-2-1-3-7-15)14-11-4-8-18(16,17)9-5-11/h11-12,14H,1-10,13H2 |
| InChIKey | HMSBRIYGHFRNCB-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1,1-dioxothian-4-yl)-1-piperidin-1-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1-dioxothian-4-yl)-1-piperidin-1-ylethane-1,2-diamine?
The IUPAC name of N-(1,1-dioxothian-4-yl)-1-piperidin-1-ylethane-1,2-diamine (CID 56611280) is N-(1,1-dioxothian-4-yl)-1-piperidin-1-ylethane-1,2-diamine.
What is the SMILES notation for N-(1,1-dioxothian-4-yl)-1-piperidin-1-ylethane-1,2-diamine?
The canonical SMILES for N-(1,1-dioxothian-4-yl)-1-piperidin-1-ylethane-1,2-diamine is NCC(NC1CCS(=O)(=O)CC1)N1CCCCC1.
What is the InChIKey of N-(1,1-dioxothian-4-yl)-1-piperidin-1-ylethane-1,2-diamine?
The InChIKey is HMSBRIYGHFRNCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3O2S/c13-10-12(15-6-2-1-3-7-15)14-11-4-8-18(16,17)9-5-11/h11-12,14H,1-10,13H2.
What are the key properties of N-(1,1-dioxothian-4-yl)-1-piperidin-1-ylethane-1,2-diamine?
N-(1,1-dioxothian-4-yl)-1-piperidin-1-ylethane-1,2-diamine has a molecular weight of 275.42 g/mol, XLogP of -0.08, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1-dioxothian-4-yl)-1-piperidin-1-ylethane-1,2-diamine is sourced from PubChem (CID 56611280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).