About (4S)-4-amino-1-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-6-methylheptane-2,3-dione
(4S)-4-amino-1-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-6-methylheptane-2,3-dione (PubChem CID 56611335) has the molecular formula C11H23NO4S
and a molecular weight of 265.38 g/mol. Its IUPAC name is (4S)-4-amino-1-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-6-methylheptane-2,3-dione.
Molecular Properties
| Compound Name | (4S)-4-amino-1-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-6-methylheptane-2,3-dione |
| PubChem CID | 56611335 |
| Molecular Formula | C11H23NO4S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (4S)-4-amino-1-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-6-methylheptane-2,3-dione |
| SMILES | CC(C)C[C@H](N)C(=O)C(=O)CS(O)(O)C(C)C |
| InChI | InChI=1S/C11H23NO4S/c1-7(2)5-9(12)11(14)10(13)6-17(15,16)8(3)4/h7-9,15-16H,5-6,12H2,1-4H3/t9-/m0/s1 |
| InChIKey | CLHFVBLPHLNDJN-VIFPVBQESA-N |
| XLogP | 1.66 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-amino-1-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-6-methylheptane-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-amino-1-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-6-methylheptane-2,3-dione?
The IUPAC name of (4S)-4-amino-1-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-6-methylheptane-2,3-dione (CID 56611335) is (4S)-4-amino-1-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-6-methylheptane-2,3-dione.
What is the SMILES notation for (4S)-4-amino-1-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-6-methylheptane-2,3-dione?
The canonical SMILES for (4S)-4-amino-1-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-6-methylheptane-2,3-dione is CC(C)C[C@H](N)C(=O)C(=O)CS(O)(O)C(C)C.
What is the InChIKey of (4S)-4-amino-1-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-6-methylheptane-2,3-dione?
The InChIKey is CLHFVBLPHLNDJN-VIFPVBQESA-N. The full InChI is InChI=1S/C11H23NO4S/c1-7(2)5-9(12)11(14)10(13)6-17(15,16)8(3)4/h7-9,15-16H,5-6,12H2,1-4H3/t9-/m0/s1.
What are the key properties of (4S)-4-amino-1-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-6-methylheptane-2,3-dione?
(4S)-4-amino-1-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-6-methylheptane-2,3-dione has a molecular weight of 265.38 g/mol, XLogP of 1.66, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-amino-1-[dihydroxy(propan-2-yl)-λ4-sulfanyl]-6-methylheptane-2,3-dione is sourced from PubChem (CID 56611335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).