C11H12N4O2S — CID 56611343
2-ethyl-8-nitro-3,4-dihydro-[1,2,5]thiadiazino[5,6-a]benzimidazole (PubChem CID 56611343) has the molecular formula C11H12N4O2S and a molecular weight of 264.31 g/mol. Its IUPAC name is 2-ethyl-8-nitro-3,4-dihydro-[1,2,5]thiadiazino[5,6-a]benzimidazole.
| Compound Name | 2-ethyl-8-nitro-3,4-dihydro-[1,2,5]thiadiazino[5,6-a]benzimidazole |
|---|---|
| PubChem CID | 56611343 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-ethyl-8-nitro-3,4-dihydro-[1,2,5]thiadiazino[5,6-a]benzimidazole |
| SMILES | CCN1CCn2c(nc3cc([N+](=O)[O-])ccc32)S1 |
| InChI | InChI=1S/C11H12N4O2S/c1-2-13-5-6-14-10-4-3-8(15(16)17)7-9(10)12-11(14)18-13/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | BAZFXOCAFQGFHZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|