C19H29F3O — CID 56611649
2-(4-pentylcyclohexyl)-5-(2,2,2-trifluoroethoxy)cyclohexa-1,3-diene (PubChem CID 56611649) has the molecular formula C19H29F3O and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-(4-pentylcyclohexyl)-5-(2,2,2-trifluoroethoxy)cyclohexa-1,3-diene.
| Compound Name | 2-(4-pentylcyclohexyl)-5-(2,2,2-trifluoroethoxy)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 56611649 |
| Molecular Formula | C19H29F3O |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 2-(4-pentylcyclohexyl)-5-(2,2,2-trifluoroethoxy)cyclohexa-1,3-diene |
| SMILES | CCCCCC1CCC(C2=CCC(OCC(F)(F)F)C=C2)CC1 |
| InChI | InChI=1S/C19H29F3O/c1-2-3-4-5-15-6-8-16(9-7-15)17-10-12-18(13-11-17)23-14-19(20,21)22/h10-12,15-16,18H,2-9,13-14H2,1H3 |
| InChIKey | HLHHWULATYIYCN-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|