About butyl-[4-[(9,9-difluoro-7-octyl-10H-phenanthren-4-yl)oxy]butyl]-dimethylsilane
butyl-[4-[(9,9-difluoro-7-octyl-10H-phenanthren-4-yl)oxy]butyl]-dimethylsilane (PubChem CID 56611667) has the molecular formula C32H48F2OSi
and a molecular weight of 514.82 g/mol. Its IUPAC name is butyl-[4-[(9,9-difluoro-7-octyl-10H-phenanthren-4-yl)oxy]butyl]-dimethylsilane.
Molecular Properties
| Compound Name | butyl-[4-[(9,9-difluoro-7-octyl-10H-phenanthren-4-yl)oxy]butyl]-dimethylsilane |
| PubChem CID | 56611667 |
| Molecular Formula | C32H48F2OSi |
| Molecular Weight | 514.82 g/mol |
| Exact Mass | 514.34 |
| IUPAC Name | butyl-[4-[(9,9-difluoro-7-octyl-10H-phenanthren-4-yl)oxy]butyl]-dimethylsilane |
| SMILES | CCCCCCCCc1ccc2c(c1)C(F)(F)Cc1cccc(OCCCC[Si](C)(C)CCCC)c1-2 |
| InChI | InChI=1S/C32H48F2OSi/c1-5-7-9-10-11-12-16-26-19-20-28-29(24-26)32(33,34)25-27-17-15-18-30(31(27)28)35-21-13-14-23-36(3,4)22-8-6-2/h15,17-20,24H,5-14,16,21-23,25H2,1-4H3 |
| InChIKey | LYXQPDRQTOYLPM-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.82 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butyl-[4-[(9,9-difluoro-7-octyl-10H-phenanthren-4-yl)oxy]butyl]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl-[4-[(9,9-difluoro-7-octyl-10H-phenanthren-4-yl)oxy]butyl]-dimethylsilane?
The IUPAC name of butyl-[4-[(9,9-difluoro-7-octyl-10H-phenanthren-4-yl)oxy]butyl]-dimethylsilane (CID 56611667) is butyl-[4-[(9,9-difluoro-7-octyl-10H-phenanthren-4-yl)oxy]butyl]-dimethylsilane.
What is the SMILES notation for butyl-[4-[(9,9-difluoro-7-octyl-10H-phenanthren-4-yl)oxy]butyl]-dimethylsilane?
The canonical SMILES for butyl-[4-[(9,9-difluoro-7-octyl-10H-phenanthren-4-yl)oxy]butyl]-dimethylsilane is CCCCCCCCc1ccc2c(c1)C(F)(F)Cc1cccc(OCCCC[Si](C)(C)CCCC)c1-2.
What is the InChIKey of butyl-[4-[(9,9-difluoro-7-octyl-10H-phenanthren-4-yl)oxy]butyl]-dimethylsilane?
The InChIKey is LYXQPDRQTOYLPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H48F2OSi/c1-5-7-9-10-11-12-16-26-19-20-28-29(24-26)32(33,34)25-27-17-15-18-30(31(27)28)35-21-13-14-23-36(3,4)22-8-6-2/h15,17-20,24H,5-14,16,21-23,25H2,1-4H3.
What are the key properties of butyl-[4-[(9,9-difluoro-7-octyl-10H-phenanthren-4-yl)oxy]butyl]-dimethylsilane?
butyl-[4-[(9,9-difluoro-7-octyl-10H-phenanthren-4-yl)oxy]butyl]-dimethylsilane has a molecular weight of 514.82 g/mol, XLogP of 10.57, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-[4-[(9,9-difluoro-7-octyl-10H-phenanthren-4-yl)oxy]butyl]-dimethylsilane is sourced from PubChem (CID 56611667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).