C17H21F7O3 — CID 56612453
2-[4-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,5-dien-1-yl]-5-propyl-1,3-dioxane (PubChem CID 56612453) has the molecular formula C17H21F7O3 and a molecular weight of 406.34 g/mol. Its IUPAC name is 2-[4-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,5-dien-1-yl]-5-propyl-1,3-dioxane.
| Compound Name | 2-[4-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,5-dien-1-yl]-5-propyl-1,3-dioxane |
|---|---|
| PubChem CID | 56612453 |
| Molecular Formula | C17H21F7O3 |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2-[4-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,5-dien-1-yl]-5-propyl-1,3-dioxane |
| SMILES | CCCC1COC(C2=CCC(OC(F)(F)C(F)(F)C(F)(F)CF)C=C2)OC1 |
| InChI | InChI=1S/C17H21F7O3/c1-2-3-11-8-25-14(26-9-11)12-4-6-13(7-5-12)27-17(23,24)16(21,22)15(19,20)10-18/h4-6,11,13-14H,2-3,7-10H2,1H3 |
| InChIKey | WKADRDXWHPPEBM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|