About tert-butyl N-[(2S,3S)-1-cyclohexyl-3-hydroxyhept-4-en-2-yl]carbamate
tert-butyl N-[(2S,3S)-1-cyclohexyl-3-hydroxyhept-4-en-2-yl]carbamate (PubChem CID 56612512) has the molecular formula C18H33NO3
and a molecular weight of 311.47 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-1-cyclohexyl-3-hydroxyhept-4-en-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2S,3S)-1-cyclohexyl-3-hydroxyhept-4-en-2-yl]carbamate |
| PubChem CID | 56612512 |
| Molecular Formula | C18H33NO3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | tert-butyl N-[(2S,3S)-1-cyclohexyl-3-hydroxyhept-4-en-2-yl]carbamate |
| SMILES | CCC=C[C@H](O)[C@H](CC1CCCCC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H33NO3/c1-5-6-12-16(20)15(13-14-10-8-7-9-11-14)19-17(21)22-18(2,3)4/h6,12,14-16,20H,5,7-11,13H2,1-4H3,(H,19,21)/t15-,16-/m0/s1 |
| InChIKey | YZBGTFIHWCZGPU-HOTGVXAUSA-N |
| XLogP | 4.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(2S,3S)-1-cyclohexyl-3-hydroxyhept-4-en-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2S,3S)-1-cyclohexyl-3-hydroxyhept-4-en-2-yl]carbamate?
The IUPAC name of tert-butyl N-[(2S,3S)-1-cyclohexyl-3-hydroxyhept-4-en-2-yl]carbamate (CID 56612512) is tert-butyl N-[(2S,3S)-1-cyclohexyl-3-hydroxyhept-4-en-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(2S,3S)-1-cyclohexyl-3-hydroxyhept-4-en-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[(2S,3S)-1-cyclohexyl-3-hydroxyhept-4-en-2-yl]carbamate is CCC=C[C@H](O)[C@H](CC1CCCCC1)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(2S,3S)-1-cyclohexyl-3-hydroxyhept-4-en-2-yl]carbamate?
The InChIKey is YZBGTFIHWCZGPU-HOTGVXAUSA-N. The full InChI is InChI=1S/C18H33NO3/c1-5-6-12-16(20)15(13-14-10-8-7-9-11-14)19-17(21)22-18(2,3)4/h6,12,14-16,20H,5,7-11,13H2,1-4H3,(H,19,21)/t15-,16-/m0/s1.
What are the key properties of tert-butyl N-[(2S,3S)-1-cyclohexyl-3-hydroxyhept-4-en-2-yl]carbamate?
tert-butyl N-[(2S,3S)-1-cyclohexyl-3-hydroxyhept-4-en-2-yl]carbamate has a molecular weight of 311.47 g/mol, XLogP of 4.18, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2S,3S)-1-cyclohexyl-3-hydroxyhept-4-en-2-yl]carbamate is sourced from PubChem (CID 56612512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).