About (6R)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhept-4-enoic acid
(6R)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhept-4-enoic acid (PubChem CID 56612824) has the molecular formula C15H30O3Si
and a molecular weight of 286.49 g/mol. Its IUPAC name is (6R)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhept-4-enoic acid.
Molecular Properties
| Compound Name | (6R)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhept-4-enoic acid |
| PubChem CID | 56612824 |
| Molecular Formula | C15H30O3Si |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | (6R)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhept-4-enoic acid |
| SMILES | C[C@H](C=CCC(C)(C)C(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O3Si/c1-12(18-19(7,8)14(2,3)4)10-9-11-15(5,6)13(16)17/h9-10,12H,11H2,1-8H3,(H,16,17)/t12-/m1/s1 |
| InChIKey | YFCKDTODIAKCPP-GFCCVEGCSA-N |
| XLogP | 4.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6R)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhept-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhept-4-enoic acid?
The IUPAC name of (6R)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhept-4-enoic acid (CID 56612824) is (6R)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhept-4-enoic acid.
What is the SMILES notation for (6R)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhept-4-enoic acid?
The canonical SMILES for (6R)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhept-4-enoic acid is C[C@H](C=CCC(C)(C)C(=O)O)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of (6R)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhept-4-enoic acid?
The InChIKey is YFCKDTODIAKCPP-GFCCVEGCSA-N. The full InChI is InChI=1S/C15H30O3Si/c1-12(18-19(7,8)14(2,3)4)10-9-11-15(5,6)13(16)17/h9-10,12H,11H2,1-8H3,(H,16,17)/t12-/m1/s1.
What are the key properties of (6R)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhept-4-enoic acid?
(6R)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhept-4-enoic acid has a molecular weight of 286.49 g/mol, XLogP of 4.45, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhept-4-enoic acid is sourced from PubChem (CID 56612824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).