C13H14O6 — CID 56612867
methyl 3-[4-(1,2,4,5-tetraoxepan-3-yl)phenyl]prop-2-enoate (PubChem CID 56612867) has the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. Its IUPAC name is methyl 3-[4-(1,2,4,5-tetraoxepan-3-yl)phenyl]prop-2-enoate.
| Compound Name | methyl 3-[4-(1,2,4,5-tetraoxepan-3-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 56612867 |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | methyl 3-[4-(1,2,4,5-tetraoxepan-3-yl)phenyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccc(C2OOCCOO2)cc1 |
| InChI | InChI=1S/C13H14O6/c1-15-12(14)7-4-10-2-5-11(6-3-10)13-18-16-8-9-17-19-13/h2-7,13H,8-9H2,1H3 |
| InChIKey | YBFAPYBDWPSTCA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|