About 2-cyclohexa-1,4-dien-1-yl-3-oxopropanoic acid
2-cyclohexa-1,4-dien-1-yl-3-oxopropanoic acid (PubChem CID 56613340) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is 2-cyclohexa-1,4-dien-1-yl-3-oxopropanoic acid.
Molecular Properties
| Compound Name | 2-cyclohexa-1,4-dien-1-yl-3-oxopropanoic acid |
| PubChem CID | 56613340 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 2-cyclohexa-1,4-dien-1-yl-3-oxopropanoic acid |
| SMILES | O=CC(C(=O)O)C1=CCC=CC1 |
| InChI | InChI=1S/C9H10O3/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-2,5-6,8H,3-4H2,(H,11,12) |
| InChIKey | YWGJUYRENZGTLN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexa-1,4-dien-1-yl-3-oxopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-1,4-dien-1-yl-3-oxopropanoic acid?
The IUPAC name of 2-cyclohexa-1,4-dien-1-yl-3-oxopropanoic acid (CID 56613340) is 2-cyclohexa-1,4-dien-1-yl-3-oxopropanoic acid.
What is the SMILES notation for 2-cyclohexa-1,4-dien-1-yl-3-oxopropanoic acid?
The canonical SMILES for 2-cyclohexa-1,4-dien-1-yl-3-oxopropanoic acid is O=CC(C(=O)O)C1=CCC=CC1.
What is the InChIKey of 2-cyclohexa-1,4-dien-1-yl-3-oxopropanoic acid?
The InChIKey is YWGJUYRENZGTLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-2,5-6,8H,3-4H2,(H,11,12).
What are the key properties of 2-cyclohexa-1,4-dien-1-yl-3-oxopropanoic acid?
2-cyclohexa-1,4-dien-1-yl-3-oxopropanoic acid has a molecular weight of 166.18 g/mol, XLogP of 1.16, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-1,4-dien-1-yl-3-oxopropanoic acid is sourced from PubChem (CID 56613340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).