C18H25F5O4 — CID 56613362
2-[4-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,5-dien-1-yl]-5-pentoxy-1,3-dioxane (PubChem CID 56613362) has the molecular formula C18H25F5O4 and a molecular weight of 400.38 g/mol. Its IUPAC name is 2-[4-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,5-dien-1-yl]-5-pentoxy-1,3-dioxane.
| Compound Name | 2-[4-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,5-dien-1-yl]-5-pentoxy-1,3-dioxane |
|---|---|
| PubChem CID | 56613362 |
| Molecular Formula | C18H25F5O4 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-[4-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,5-dien-1-yl]-5-pentoxy-1,3-dioxane |
| SMILES | CCCCCOC1COC(C2=CCC(OC(F)(F)C(F)(F)CF)C=C2)OC1 |
| InChI | InChI=1S/C18H25F5O4/c1-2-3-4-9-24-15-10-25-16(26-11-15)13-5-7-14(8-6-13)27-18(22,23)17(20,21)12-19/h5-7,14-16H,2-4,8-12H2,1H3 |
| InChIKey | PXOZYDPJOASUBL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|