C6H8N4O — CID 56613505
6-methyl-1,3,4,7-tetrahydropurin-2-one (PubChem CID 56613505) has the molecular formula C6H8N4O and a molecular weight of 152.16 g/mol. Its IUPAC name is 6-methyl-1,3,4,7-tetrahydropurin-2-one.
| Compound Name | 6-methyl-1,3,4,7-tetrahydropurin-2-one |
|---|---|
| PubChem CID | 56613505 |
| Molecular Formula | C6H8N4O |
| Molecular Weight | 152.16 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 6-methyl-1,3,4,7-tetrahydropurin-2-one |
| SMILES | CC1=C2NC=NC2NC(=O)N1 |
| InChI | InChI=1S/C6H8N4O/c1-3-4-5(8-2-7-4)10-6(11)9-3/h2,5H,1H3,(H,7,8)(H2,9,10,11) |
| InChIKey | MOKNPJUUCJIPGF-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.16 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |